C18H9F8N5O — CID 86580621
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2,6-difluoro-3-pyridinyl)prop-2-enamide (PubChem CID 86580621) has the molecular formula C18H9F8N5O and a molecular weight of 463.29 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2,6-difluoro-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2,6-difluoro-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 86580621 |
| Molecular Formula | C18H9F8N5O |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2,6-difluoro-3-pyridinyl)prop-2-enamide |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccc(F)nc1F |
| InChI | InChI=1S/C18H9F8N5O/c19-13-2-1-11(14(20)29-13)12(15(27)32)6-31-7-28-16(30-31)8-3-9(17(21,22)23)5-10(4-8)18(24,25)26/h1-7H,(H2,27,32)/b12-6+ |
| InChIKey | BRBSLTGVCYIYKP-WUXMJOGZSA-N |
| XLogP | 4.14 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|