C18H10F6N4O2 — CID 86580622
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-4-ylprop-2-enoic acid (PubChem CID 86580622) has the molecular formula C18H10F6N4O2 and a molecular weight of 428.29 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-4-ylprop-2-enoic acid.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-4-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 86580622 |
| Molecular Formula | C18H10F6N4O2 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-4-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccncc1 |
| InChI | InChI=1S/C18H10F6N4O2/c19-17(20,21)12-5-11(6-13(7-12)18(22,23)24)15-26-9-28(27-15)8-14(16(29)30)10-1-3-25-4-2-10/h1-9H,(H,29,30)/b14-8+ |
| InChIKey | ZGSXVHFIJHGPJL-RIYZIHGNSA-N |
| XLogP | 4.46 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|