C19H19F7N6 — CID 86580656
2-N,4-N-bis(3,3-difluorocyclopentyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine (PubChem CID 86580656) has the molecular formula C19H19F7N6 and a molecular weight of 464.39 g/mol. Its IUPAC name is 2-N,4-N-bis(3,3-difluorocyclopentyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3,3-difluorocyclopentyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 86580656 |
| Molecular Formula | C19H19F7N6 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-N,4-N-bis(3,3-difluorocyclopentyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC1(F)CCC(Nc2nc(NC3CCC(F)(F)C3)nc(-c3cccc(C(F)(F)F)n3)n2)C1 |
| InChI | InChI=1S/C19H19F7N6/c20-17(21)6-4-10(8-17)27-15-30-14(12-2-1-3-13(29-12)19(24,25)26)31-16(32-15)28-11-5-7-18(22,23)9-11/h1-3,10-11H,4-9H2,(H2,27,28,30,31,32) |
| InChIKey | JWMKUJAOIPXYIG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |