C19H21ClN4O2S — CID 86580707
2-(4-chlorophenyl)-2-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-ylidene]acetonitrile (PubChem CID 86580707) has the molecular formula C19H21ClN4O2S and a molecular weight of 404.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-ylidene]acetonitrile.
| Compound Name | 2-(4-chlorophenyl)-2-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 86580707 |
| Molecular Formula | C19H21ClN4O2S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-ylidene]acetonitrile |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(=C(C#N)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21ClN4O2S/c1-13-19(14(2)23(3)22-13)27(25,26)24-10-8-16(9-11-24)18(12-21)15-4-6-17(20)7-5-15/h4-7H,8-11H2,1-3H3 |
| InChIKey | YZLYZJPLSNEUDJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|