C22H13F6N5O — CID 86580948
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-quinolin-3-ylprop-2-enamide (PubChem CID 86580948) has the molecular formula C22H13F6N5O and a molecular weight of 477.37 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-quinolin-3-ylprop-2-enamide.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-quinolin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 86580948 |
| Molecular Formula | C22H13F6N5O |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-quinolin-3-ylprop-2-enamide |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C22H13F6N5O/c23-21(24,25)15-6-13(7-16(8-15)22(26,27)28)20-31-11-33(32-20)10-17(19(29)34)14-5-12-3-1-2-4-18(12)30-9-14/h1-11H,(H2,29,34)/b17-10+ |
| InChIKey | VGWRNTZZDAEVCV-LICLKQGHSA-N |
| XLogP | 5.01 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|