About 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline
3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline (PubChem CID 86581018) has the molecular formula C20H21FN4O2S
and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline.
Molecular Properties
| Compound Name | 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline |
| PubChem CID | 86581018 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(=C(F)c2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C20H21FN4O2S/c1-13-20(14(2)24-23-13)28(26,27)25-9-7-15(8-10-25)19(21)17-11-16-5-3-4-6-18(16)22-12-17/h3-6,11-12H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | JTGYOXKVMCWCBO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline?
The IUPAC name of 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline (CID 86581018) is 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline.
What is the SMILES notation for 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline?
The canonical SMILES for 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline is Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(=C(F)c2cnc3ccccc3c2)CC1.
What is the InChIKey of 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline?
The InChIKey is JTGYOXKVMCWCBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN4O2S/c1-13-20(14(2)24-23-13)28(26,27)25-9-7-15(8-10-25)19(21)17-11-16-5-3-4-6-18(16)22-12-17/h3-6,11-12H,7-10H2,1-2H3,(H,23,24).
What are the key properties of 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline?
3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline has a molecular weight of 400.48 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-fluoromethyl]quinoline is sourced from PubChem (CID 86581018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).