C20H15F6N5O — CID 86581093
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N,N-dimethyl-2-pyridin-3-ylprop-2-enamide (PubChem CID 86581093) has the molecular formula C20H15F6N5O and a molecular weight of 455.36 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N,N-dimethyl-2-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N,N-dimethyl-2-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 86581093 |
| Molecular Formula | C20H15F6N5O |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N,N-dimethyl-2-pyridin-3-ylprop-2-enamide |
| SMILES | CN(C)C(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cccnc1 |
| InChI | InChI=1S/C20H15F6N5O/c1-30(2)18(32)16(12-4-3-5-27-9-12)10-31-11-28-17(29-31)13-6-14(19(21,22)23)8-15(7-13)20(24,25)26/h3-11H,1-2H3/b16-10+ |
| InChIKey | XEOGZSNDZVPUAG-MHWRWJLKSA-N |
| XLogP | 4.46 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|