C17H11F6N5O2 — CID 86581094
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoic acid (PubChem CID 86581094) has the molecular formula C17H11F6N5O2 and a molecular weight of 431.30 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 86581094 |
| Molecular Formula | C17H11F6N5O2 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoic acid |
| SMILES | Cn1cc(/C(=C\n2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C(=O)O)cn1 |
| InChI | InChI=1S/C17H11F6N5O2/c1-27-6-10(5-25-27)13(15(29)30)7-28-8-24-14(26-28)9-2-11(16(18,19)20)4-12(3-9)17(21,22)23/h2-8H,1H3,(H,29,30)/b13-7+ |
| InChIKey | UAHKFVLKHIDOLM-NTUHNPAUSA-N |
| XLogP | 3.80 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|