C20H29N3O4 — CID 86581294
N'-hydroxy-N-(1,4,4-trimethyl-2-oxo-3H-quinolin-6-yl)octanediamide (PubChem CID 86581294) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is N'-hydroxy-N-(1,4,4-trimethyl-2-oxo-3H-quinolin-6-yl)octanediamide.
| Compound Name | N'-hydroxy-N-(1,4,4-trimethyl-2-oxo-3H-quinolin-6-yl)octanediamide |
|---|---|
| PubChem CID | 86581294 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N'-hydroxy-N-(1,4,4-trimethyl-2-oxo-3H-quinolin-6-yl)octanediamide |
| SMILES | CN1C(=O)CC(C)(C)c2cc(NC(=O)CCCCCCC(=O)NO)ccc21 |
| InChI | InChI=1S/C20H29N3O4/c1-20(2)13-19(26)23(3)16-11-10-14(12-15(16)20)21-17(24)8-6-4-5-7-9-18(25)22-27/h10-12,27H,4-9,13H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | KCARGDLUZPOPSG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|