C17H11F6N7O — CID 86581374
(E)-2-(2-aminopyrimidin-5-yl)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide (PubChem CID 86581374) has the molecular formula C17H11F6N7O and a molecular weight of 443.31 g/mol. Its IUPAC name is (E)-2-(2-aminopyrimidin-5-yl)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide.
| Compound Name | (E)-2-(2-aminopyrimidin-5-yl)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 86581374 |
| Molecular Formula | C17H11F6N7O |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (E)-2-(2-aminopyrimidin-5-yl)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cnc(N)nc1 |
| InChI | InChI=1S/C17H11F6N7O/c18-16(19,20)10-1-8(2-11(3-10)17(21,22)23)14-28-7-30(29-14)6-12(13(24)31)9-4-26-15(25)27-5-9/h1-7H,(H2,24,31)(H2,25,26,27)/b12-6+ |
| InChIKey | VXHANZPODLKINF-WUXMJOGZSA-N |
| XLogP | 2.84 |
| TPSA | 125.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|