C22H27FO2 — CID 86581445
2-[(1R,2S,5R)-2-ethenyl-2-methyl-5-prop-1-en-2-ylcyclohexyl]prop-2-enyl 4-fluorobenzoate (PubChem CID 86581445) has the molecular formula C22H27FO2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-[(1R,2S,5R)-2-ethenyl-2-methyl-5-prop-1-en-2-ylcyclohexyl]prop-2-enyl 4-fluorobenzoate.
| Compound Name | 2-[(1R,2S,5R)-2-ethenyl-2-methyl-5-prop-1-en-2-ylcyclohexyl]prop-2-enyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 86581445 |
| Molecular Formula | C22H27FO2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-[(1R,2S,5R)-2-ethenyl-2-methyl-5-prop-1-en-2-ylcyclohexyl]prop-2-enyl 4-fluorobenzoate |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)C)C[C@H]1C(=C)COC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FO2/c1-6-22(5)12-11-18(15(2)3)13-20(22)16(4)14-25-21(24)17-7-9-19(23)10-8-17/h6-10,18,20H,1-2,4,11-14H2,3,5H3/t18-,20+,22-/m1/s1 |
| InChIKey | NMDLDSVMKMHBEI-KAGYGMCKSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|