C25H32O8 — CID 86581492
[(1R,2E,8S,10R,11S)-11-hydroxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate (PubChem CID 86581492) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is [(1R,2E,8S,10R,11S)-11-hydroxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2E,8S,10R,11S)-11-hydroxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 86581492 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [(1R,2E,8S,10R,11S)-11-hydroxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCC1=C2/C(=C\[C@@]3(C)CC[C@](O)(O3)[C@H](C)C[C@@H]2OC(=O)/C(C)=C/C)OC1=O |
| InChI | InChI=1S/C25H32O8/c1-7-14(3)21(26)30-13-17-20-18(31-22(27)15(4)8-2)11-16(5)25(29)10-9-24(6,33-25)12-19(20)32-23(17)28/h7-8,12,16,18,29H,9-11,13H2,1-6H3/b14-7+,15-8+,19-12+/t16-,18+,24-,25+/m1/s1 |
| InChIKey | SXWMMXLLUPPRDM-MJEOIREYSA-N |
| XLogP | 3.41 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|