C26H34O8 — CID 86581493
[(1R,2E,8S,10R,11S)-11-methoxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate (PubChem CID 86581493) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(1R,2E,8S,10R,11S)-11-methoxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2E,8S,10R,11S)-11-methoxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 86581493 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(1R,2E,8S,10R,11S)-11-methoxy-1,10-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCC1=C2/C(=C\[C@@]3(C)CC[C@](OC)(O3)[C@H](C)C[C@@H]2OC(=O)/C(C)=C/C)OC1=O |
| InChI | InChI=1S/C26H34O8/c1-8-15(3)22(27)31-14-18-21-19(32-23(28)16(4)9-2)12-17(5)26(30-7)11-10-25(6,34-26)13-20(21)33-24(18)29/h8-9,13,17,19H,10-12,14H2,1-7H3/b15-8+,16-9+,20-13+/t17-,19+,25-,26+/m1/s1 |
| InChIKey | SIFJILBMCXMOIY-PWYNCQELSA-N |
| XLogP | 4.06 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|