C17H9F7N6O — CID 86581515
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide (PubChem CID 86581515) has the molecular formula C17H9F7N6O and a molecular weight of 446.29 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 86581515 |
| Molecular Formula | C17H9F7N6O |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cnc(F)nc1 |
| InChI | InChI=1S/C17H9F7N6O/c18-15-26-4-9(5-27-15)12(13(25)31)6-30-7-28-14(29-30)8-1-10(16(19,20)21)3-11(2-8)17(22,23)24/h1-7H,(H2,25,31)/b12-6+ |
| InChIKey | JCSNMEJLNJVUKW-WUXMJOGZSA-N |
| XLogP | 3.40 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|