About 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one
2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one (PubChem CID 86581560) has the molecular formula C26H31N3O
and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one |
| PubChem CID | 86581560 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one |
| SMILES | CC(C(=O)N1CCn2c(cc3ccccc32)C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O/c1-20(27-13-11-22(12-14-27)17-21-7-3-2-4-8-21)26(30)28-15-16-29-24(19-28)18-23-9-5-6-10-25(23)29/h2-10,18,20,22H,11-17,19H2,1H3 |
| InChIKey | IEXXXIAEAIDKNP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one?
The IUPAC name of 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one (CID 86581560) is 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one.
What is the SMILES notation for 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one?
The canonical SMILES for 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one is CC(C(=O)N1CCn2c(cc3ccccc32)C1)N1CCC(Cc2ccccc2)CC1.
What is the InChIKey of 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one?
The InChIKey is IEXXXIAEAIDKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31N3O/c1-20(27-13-11-22(12-14-27)17-21-7-3-2-4-8-21)26(30)28-15-16-29-24(19-28)18-23-9-5-6-10-25(23)29/h2-10,18,20,22H,11-17,19H2,1H3.
What are the key properties of 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one?
2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one has a molecular weight of 401.55 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzylpiperidin-1-yl)-1-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-one is sourced from PubChem (CID 86581560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).