C23H34O7 — CID 86581636
[(1R,2E,8S,10R,11S)-8,11-dihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl 2-propylpentanoate (PubChem CID 86581636) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(1R,2E,8S,10R,11S)-8,11-dihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl 2-propylpentanoate.
| Compound Name | [(1R,2E,8S,10R,11S)-8,11-dihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl 2-propylpentanoate |
|---|---|
| PubChem CID | 86581636 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(1R,2E,8S,10R,11S)-8,11-dihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCC1=C2/C(=C\[C@@]3(C)CC[C@](O)(O3)[C@H](C)C[C@@H]2O)OC1=O |
| InChI | InChI=1S/C23H34O7/c1-5-7-15(8-6-2)20(25)28-13-16-19-17(24)11-14(3)23(27)10-9-22(4,30-23)12-18(19)29-21(16)26/h12,14-15,17,24,27H,5-11,13H2,1-4H3/b18-12+/t14-,17+,22-,23+/m1/s1 |
| InChIKey | AZFWOTIVXVKTGN-JOCZCXJSSA-N |
| XLogP | 3.14 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |