C24H21F6NO — CID 86581647
(3E,5E)-1-propyl-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-4-one (PubChem CID 86581647) has the molecular formula C24H21F6NO and a molecular weight of 453.43 g/mol. Its IUPAC name is (3E,5E)-1-propyl-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-propyl-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 86581647 |
| Molecular Formula | C24H21F6NO |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (3E,5E)-1-propyl-3,5-bis[[4-(trifluoromethyl)phenyl]methylidene]piperidin-4-one |
| SMILES | CCCN1C/C(=C\c2ccc(C(F)(F)F)cc2)C(=O)/C(=C/c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H21F6NO/c1-2-11-31-14-18(12-16-3-7-20(8-4-16)23(25,26)27)22(32)19(15-31)13-17-5-9-21(10-6-17)24(28,29)30/h3-10,12-13H,2,11,14-15H2,1H3/b18-12+,19-13+ |
| InChIKey | KDDQZSOJZRRGIT-KLCVKJMQSA-N |
| XLogP | 6.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|