C13H9ClFN3O — CID 86581712
3-N-(3-chloro-4-fluorophenyl)furo[2,3-c]pyridine-2,3-diamine (PubChem CID 86581712) has the molecular formula C13H9ClFN3O and a molecular weight of 277.69 g/mol. Its IUPAC name is 3-N-(3-chloro-4-fluorophenyl)furo[2,3-c]pyridine-2,3-diamine.
| Compound Name | 3-N-(3-chloro-4-fluorophenyl)furo[2,3-c]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 86581712 |
| Molecular Formula | C13H9ClFN3O |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-N-(3-chloro-4-fluorophenyl)furo[2,3-c]pyridine-2,3-diamine |
| SMILES | Nc1oc2cnccc2c1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H9ClFN3O/c14-9-5-7(1-2-10(9)15)18-12-8-3-4-17-6-11(8)19-13(12)16/h1-6,18H,16H2 |
| InChIKey | MAFDXEXXQIAQTR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |