C21H22BrN3O4 — CID 86581805
5-bromo-1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2,3-dihydroindole-2-carboxylic acid (PubChem CID 86581805) has the molecular formula C21H22BrN3O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is 5-bromo-1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 5-bromo-1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 86581805 |
| Molecular Formula | C21H22BrN3O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 5-bromo-1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2,3-dihydroindole-2-carboxylic acid |
| SMILES | COc1ccc(N2CCN(C(=O)N3c4ccc(Br)cc4CC3C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C21H22BrN3O4/c1-29-17-5-3-16(4-6-17)23-8-10-24(11-9-23)21(28)25-18-7-2-15(22)12-14(18)13-19(25)20(26)27/h2-7,12,19H,8-11,13H2,1H3,(H,26,27) |
| InChIKey | YKJXMRNCGXZRCM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|