C13H8F3N3O — CID 86581861
3-N-(2,4,5-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine (PubChem CID 86581861) has the molecular formula C13H8F3N3O and a molecular weight of 279.22 g/mol. Its IUPAC name is 3-N-(2,4,5-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine.
| Compound Name | 3-N-(2,4,5-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 86581861 |
| Molecular Formula | C13H8F3N3O |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-N-(2,4,5-trifluorophenyl)furo[2,3-c]pyridine-2,3-diamine |
| SMILES | Nc1oc2cnccc2c1Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H8F3N3O/c14-7-3-9(16)10(4-8(7)15)19-12-6-1-2-18-5-11(6)20-13(12)17/h1-5,19H,17H2 |
| InChIKey | ZORGHSGBCUOMQX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|