C28H38N2SSi — CID 86581874
4,4-dimethyl-1-[[2-methyl-5-(4-methylsulfanylphenyl)-1-(4-propan-2-ylphenyl)pyrrol-3-yl]methyl]-1,4-azasilinane (PubChem CID 86581874) has the molecular formula C28H38N2SSi and a molecular weight of 462.78 g/mol. Its IUPAC name is 4,4-dimethyl-1-[[2-methyl-5-(4-methylsulfanylphenyl)-1-(4-propan-2-ylphenyl)pyrrol-3-yl]methyl]-1,4-azasilinane.
| Compound Name | 4,4-dimethyl-1-[[2-methyl-5-(4-methylsulfanylphenyl)-1-(4-propan-2-ylphenyl)pyrrol-3-yl]methyl]-1,4-azasilinane |
|---|---|
| PubChem CID | 86581874 |
| Molecular Formula | C28H38N2SSi |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4,4-dimethyl-1-[[2-methyl-5-(4-methylsulfanylphenyl)-1-(4-propan-2-ylphenyl)pyrrol-3-yl]methyl]-1,4-azasilinane |
| SMILES | CSc1ccc(-c2cc(CN3CC[Si](C)(C)CC3)c(C)n2-c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H38N2SSi/c1-21(2)23-7-11-26(12-8-23)30-22(3)25(20-29-15-17-32(5,6)18-16-29)19-28(30)24-9-13-27(31-4)14-10-24/h7-14,19,21H,15-18,20H2,1-6H3 |
| InChIKey | DRCBRGQCEPAEAE-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|