C17H22N2O4 — CID 86582260
1-[2-(3-hydroxy-1-adamantyl)-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide (PubChem CID 86582260) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[2-(3-hydroxy-1-adamantyl)-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide.
| Compound Name | 1-[2-(3-hydroxy-1-adamantyl)-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86582260 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[2-(3-hydroxy-1-adamantyl)-2-oxoacetyl]-2,3-dihydropyrrole-2-carboxamide |
| SMILES | NC(=O)C1CC=CN1C(=O)C(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C17H22N2O4/c18-14(21)12-2-1-3-19(12)15(22)13(20)16-5-10-4-11(6-16)8-17(23,7-10)9-16/h1,3,10-12,23H,2,4-9H2,(H2,18,21) |
| InChIKey | MZWANDJOFJGLCG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|