C24H26ClNO8 — CID 86582535
diethyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]pentanedioate;hydrochloride (PubChem CID 86582535) has the molecular formula C24H26ClNO8 and a molecular weight of 491.92 g/mol. Its IUPAC name is diethyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]pentanedioate;hydrochloride.
| Compound Name | diethyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]pentanedioate;hydrochloride |
|---|---|
| PubChem CID | 86582535 |
| Molecular Formula | C24H26ClNO8 |
| Molecular Weight | 491.92 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | diethyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]pentanedioate;hydrochloride |
| SMILES | CCOC(=O)CC[C@H](NCc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O)C(=O)OCC.Cl |
| InChI | InChI=1S/C24H25NO8.ClH/c1-3-32-19(28)9-8-16(24(31)33-4-2)25-12-13-10-15-21(18(27)11-13)23(30)20-14(22(15)29)6-5-7-17(20)26;/h5-7,10-11,16,25-27H,3-4,8-9,12H2,1-2H3;1H/t16-;/m0./s1 |
| InChIKey | KEFUUHHKAXRYBU-NTISSMGPSA-N |
| XLogP | 2.66 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.92 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|