C23H30N2O3 — CID 86582595
(1S,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide (PubChem CID 86582595) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is (1S,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1S,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 86582595 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (1S,9R,10S)-17-(cyclobutylmethyl)-3,10-dihydroxy-13-methylidene-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
| SMILES | C=C1CC[C@@]2(O)[C@H]3Cc4ccc(C(N)=O)c(O)c4[C@@]2(CCN3CC2CCC2)C1 |
| InChI | InChI=1S/C23H30N2O3/c1-14-7-8-23(28)18-11-16-5-6-17(21(24)27)20(26)19(16)22(23,12-14)9-10-25(18)13-15-3-2-4-15/h5-6,15,18,26,28H,1-4,7-13H2,(H2,24,27)/t18-,22-,23-/m1/s1 |
| InChIKey | PXJFQIMTTRRZHS-SXSPYAJSSA-N |
| XLogP | 2.63 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|