C21H16F6N4O2 — CID 86582732
propan-2-yl (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enoate (PubChem CID 86582732) has the molecular formula C21H16F6N4O2 and a molecular weight of 470.37 g/mol. Its IUPAC name is propan-2-yl (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enoate.
| Compound Name | propan-2-yl (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 86582732 |
| Molecular Formula | C21H16F6N4O2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | propan-2-yl (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enoate |
| SMILES | CC(C)OC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cccnc1 |
| InChI | InChI=1S/C21H16F6N4O2/c1-12(2)33-19(32)17(13-4-3-5-28-9-13)10-31-11-29-18(30-31)14-6-15(20(22,23)24)8-16(7-14)21(25,26)27/h3-12H,1-2H3/b17-10+ |
| InChIKey | DYPMOSBAUYLNHV-LICLKQGHSA-N |
| XLogP | 5.33 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|