C19H12F6N4O3 — CID 86582736
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enoic acid (PubChem CID 86582736) has the molecular formula C19H12F6N4O3 and a molecular weight of 458.32 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 86582736 |
| Molecular Formula | C19H12F6N4O3 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C\n2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C(=O)O)cn1 |
| InChI | InChI=1S/C19H12F6N4O3/c1-32-15-3-2-10(7-26-15)14(17(30)31)8-29-9-27-16(28-29)11-4-12(18(20,21)22)6-13(5-11)19(23,24)25/h2-9H,1H3,(H,30,31)/b14-8+ |
| InChIKey | YNOKWYMWDIFOOQ-RIYZIHGNSA-N |
| XLogP | 4.47 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|