C18H11F6N5O — CID 86582891
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enamide (PubChem CID 86582891) has the molecular formula C18H11F6N5O and a molecular weight of 427.31 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 86582891 |
| Molecular Formula | C18H11F6N5O |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enamide |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cccnc1 |
| InChI | InChI=1S/C18H11F6N5O/c19-17(20,21)12-4-11(5-13(6-12)18(22,23)24)16-27-9-29(28-16)8-14(15(25)30)10-2-1-3-26-7-10/h1-9H,(H2,25,30)/b14-8+ |
| InChIKey | XYHBQQRQQFWGFY-RIYZIHGNSA-N |
| XLogP | 3.86 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|