C20H13Cl3F7N3O2 — CID 86582954
N'-[2-chloro-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-4,4,4-trifluorobutanehydrazide (PubChem CID 86582954) has the molecular formula C20H13Cl3F7N3O2 and a molecular weight of 566.69 g/mol. Its IUPAC name is N'-[2-chloro-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-4,4,4-trifluorobutanehydrazide.
| Compound Name | N'-[2-chloro-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-4,4,4-trifluorobutanehydrazide |
|---|---|
| PubChem CID | 86582954 |
| Molecular Formula | C20H13Cl3F7N3O2 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | N'-[2-chloro-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-4,4,4-trifluorobutanehydrazide |
| SMILES | O=C(CCC(F)(F)F)NNc1cc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C20H13Cl3F7N3O2/c21-11-2-1-9(5-14(11)31-32-16(34)3-4-19(25,26)27)15-8-18(35-33-15,20(28,29)30)10-6-12(22)17(24)13(23)7-10/h1-2,5-7,31H,3-4,8H2,(H,32,34) |
| InChIKey | BESVFKFDGDTMCE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|