C32H27N5O2S — CID 86583044
4-[2-amino-4-methyl-3-[2-(methylamino)-1,3-benzothiazol-6-yl]benzoyl]-1-methyl-2,5-diphenylpyrazol-3-one (PubChem CID 86583044) has the molecular formula C32H27N5O2S and a molecular weight of 545.67 g/mol. Its IUPAC name is 4-[2-amino-4-methyl-3-[2-(methylamino)-1,3-benzothiazol-6-yl]benzoyl]-1-methyl-2,5-diphenylpyrazol-3-one.
| Compound Name | 4-[2-amino-4-methyl-3-[2-(methylamino)-1,3-benzothiazol-6-yl]benzoyl]-1-methyl-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 86583044 |
| Molecular Formula | C32H27N5O2S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 4-[2-amino-4-methyl-3-[2-(methylamino)-1,3-benzothiazol-6-yl]benzoyl]-1-methyl-2,5-diphenylpyrazol-3-one |
| SMILES | CNc1nc2ccc(-c3c(C)ccc(C(=O)c4c(-c5ccccc5)n(C)n(-c5ccccc5)c4=O)c3N)cc2s1 |
| InChI | InChI=1S/C32H27N5O2S/c1-19-14-16-23(28(33)26(19)21-15-17-24-25(18-21)40-32(34-2)35-24)30(38)27-29(20-10-6-4-7-11-20)36(3)37(31(27)39)22-12-8-5-9-13-22/h4-18H,33H2,1-3H3,(H,34,35) |
| InChIKey | XUIZYNXJUPSUNY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|