About 5-aminoquinolin-3-ol
5-aminoquinolin-3-ol (PubChem CID 86583081) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 5-aminoquinolin-3-ol.
Molecular Properties
| Compound Name | 5-aminoquinolin-3-ol |
| PubChem CID | 86583081 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 5-aminoquinolin-3-ol |
| SMILES | Nc1cccc2ncc(O)cc12 |
| InChI | InChI=1S/C9H8N2O/c10-8-2-1-3-9-7(8)4-6(12)5-11-9/h1-5,12H,10H2 |
| InChIKey | YMXQIJJAGDBYPH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-aminoquinolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminoquinolin-3-ol?
The IUPAC name of 5-aminoquinolin-3-ol (CID 86583081) is 5-aminoquinolin-3-ol.
What is the SMILES notation for 5-aminoquinolin-3-ol?
The canonical SMILES for 5-aminoquinolin-3-ol is Nc1cccc2ncc(O)cc12.
What is the InChIKey of 5-aminoquinolin-3-ol?
The InChIKey is YMXQIJJAGDBYPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c10-8-2-1-3-9-7(8)4-6(12)5-11-9/h1-5,12H,10H2.
What are the key properties of 5-aminoquinolin-3-ol?
5-aminoquinolin-3-ol has a molecular weight of 160.18 g/mol, XLogP of 1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminoquinolin-3-ol is sourced from PubChem (CID 86583081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).