About N-(4-acetyl-1,2,4-triazol-3-yl)acetamide
N-(4-acetyl-1,2,4-triazol-3-yl)acetamide (PubChem CID 86583172) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is N-(4-acetyl-1,2,4-triazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-acetyl-1,2,4-triazol-3-yl)acetamide |
| PubChem CID | 86583172 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | N-(4-acetyl-1,2,4-triazol-3-yl)acetamide |
| SMILES | CC(=O)Nc1nncn1C(C)=O |
| InChI | InChI=1S/C6H8N4O2/c1-4(11)8-6-9-7-3-10(6)5(2)12/h3H,1-2H3,(H,8,9,11) |
| InChIKey | OQWGJIPLLFNWEX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-acetyl-1,2,4-triazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetyl-1,2,4-triazol-3-yl)acetamide?
The IUPAC name of N-(4-acetyl-1,2,4-triazol-3-yl)acetamide (CID 86583172) is N-(4-acetyl-1,2,4-triazol-3-yl)acetamide.
What is the SMILES notation for N-(4-acetyl-1,2,4-triazol-3-yl)acetamide?
The canonical SMILES for N-(4-acetyl-1,2,4-triazol-3-yl)acetamide is CC(=O)Nc1nncn1C(C)=O.
What is the InChIKey of N-(4-acetyl-1,2,4-triazol-3-yl)acetamide?
The InChIKey is OQWGJIPLLFNWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c1-4(11)8-6-9-7-3-10(6)5(2)12/h3H,1-2H3,(H,8,9,11).
What are the key properties of N-(4-acetyl-1,2,4-triazol-3-yl)acetamide?
N-(4-acetyl-1,2,4-triazol-3-yl)acetamide has a molecular weight of 168.16 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetyl-1,2,4-triazol-3-yl)acetamide is sourced from PubChem (CID 86583172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).