C58H77FeP — CID 86583277
ditert-butyl(cyclopentyl)phosphane;1,3-dimethyl-5-[2,3,4,5-tetrakis(3,5-dimethylphenyl)cyclopentyl]benzene;iron (PubChem CID 86583277) has the molecular formula C58H77FeP and a molecular weight of 861.07 g/mol. Its IUPAC name is ditert-butyl(cyclopentyl)phosphane;1,3-dimethyl-5-[2,3,4,5-tetrakis(3,5-dimethylphenyl)cyclopentyl]benzene;iron.
| Compound Name | ditert-butyl(cyclopentyl)phosphane;1,3-dimethyl-5-[2,3,4,5-tetrakis(3,5-dimethylphenyl)cyclopentyl]benzene;iron |
|---|---|
| PubChem CID | 86583277 |
| Molecular Formula | C58H77FeP |
| Molecular Weight | 861.07 g/mol |
| Exact Mass | 860.51 |
| IUPAC Name | ditert-butyl(cyclopentyl)phosphane;1,3-dimethyl-5-[2,3,4,5-tetrakis(3,5-dimethylphenyl)cyclopentyl]benzene;iron |
| SMILES | CC(C)(C)P(C1CCCC1)C(C)(C)C.Cc1cc(C)cc(C2C(c3cc(C)cc(C)c3)C(c3cc(C)cc(C)c3)C(c3cc(C)cc(C)c3)C2c2cc(C)cc(C)c2)c1.[Fe] |
| InChI | InChI=1S/C45H50.C13H27P.Fe/c1-26-11-27(2)17-36(16-26)41-42(37-18-28(3)12-29(4)19-37)44(39-22-32(7)14-33(8)23-39)45(40-24-34(9)15-35(10)25-40)43(41)38-20-30(5)13-31(6)21-38;1-12(2,3)14(13(4,5)6)11-9-7-8-10-11;/h11-25,41-45H,1-10H3;11H,7-10H2,1-6H3; |
| InChIKey | REOASZKVUDDVQF-UHFFFAOYSA-N |
| XLogP | 17.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.07 |
| LogP ≤ 5 | 17.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|