About prop-2-ynyl nitrate
prop-2-ynyl nitrate (PubChem CID 86583284) has the molecular formula C3H3NO3
and a molecular weight of 101.06 g/mol. Its IUPAC name is prop-2-ynyl nitrate.
Molecular Properties
| Compound Name | prop-2-ynyl nitrate |
| PubChem CID | 86583284 |
| Molecular Formula | C3H3NO3 |
| Molecular Weight | 101.06 g/mol |
| Exact Mass | 101.01 |
| IUPAC Name | prop-2-ynyl nitrate |
| SMILES | C#CCO[N+](=O)[O-] |
| InChI | InChI=1S/C3H3NO3/c1-2-3-7-4(5)6/h1H,3H2 |
| InChIKey | CTJUAVGJEZYQOF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.06 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl nitrate?
The IUPAC name of prop-2-ynyl nitrate (CID 86583284) is prop-2-ynyl nitrate.
What is the SMILES notation for prop-2-ynyl nitrate?
The canonical SMILES for prop-2-ynyl nitrate is C#CCO[N+](=O)[O-].
What is the InChIKey of prop-2-ynyl nitrate?
The InChIKey is CTJUAVGJEZYQOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NO3/c1-2-3-7-4(5)6/h1H,3H2.
What are the key properties of prop-2-ynyl nitrate?
prop-2-ynyl nitrate has a molecular weight of 101.06 g/mol, XLogP of -0.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl nitrate is sourced from PubChem (CID 86583284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).