About [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide
[amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide (PubChem CID 86583299) has the molecular formula C2H8N8O4
and a molecular weight of 208.14 g/mol. Its IUPAC name is [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide.
Molecular Properties
| Compound Name | [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide |
| PubChem CID | 86583299 |
| Molecular Formula | C2H8N8O4 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide |
| SMILES | NC(=[NH2+])N=C(N)N.O=[N+]([O-])[N-][N+](=O)[O-] |
| InChI | InChI=1S/C2H7N5.N3O4/c3-1(4)7-2(5)6;4-2(5)1-3(6)7/h(H7,3,4,5,6,7);/q;-1/p+1 |
| InChIKey | LZXBUCAIMJSOQQ-UHFFFAOYSA-O |
| XLogP | -3.92 |
| TPSA | 216.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide?
The IUPAC name of [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide (CID 86583299) is [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide.
What is the SMILES notation for [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide?
The canonical SMILES for [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide is NC(=[NH2+])N=C(N)N.O=[N+]([O-])[N-][N+](=O)[O-].
What is the InChIKey of [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide?
The InChIKey is LZXBUCAIMJSOQQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H7N5.N3O4/c3-1(4)7-2(5)6;4-2(5)1-3(6)7/h(H7,3,4,5,6,7);/q;-1/p+1.
What are the key properties of [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide?
[amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide has a molecular weight of 208.14 g/mol, XLogP of -3.92, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-(diaminomethylideneamino)methylidene]azanium;dinitroazanide is sourced from PubChem (CID 86583299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).