C9H11O5- — CID 86583393
3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]-2-oxopropanoate (PubChem CID 86583393) has the molecular formula C9H11O5- and a molecular weight of 199.18 g/mol. Its IUPAC name is 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]-2-oxopropanoate.
| Compound Name | 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]-2-oxopropanoate |
|---|---|
| PubChem CID | 86583393 |
| Molecular Formula | C9H11O5- |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]-2-oxopropanoate |
| SMILES | O=C([O-])C(=O)C[C@@H]1CC[C@@H](O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C9H12O5/c10-5-2-1-4(7-8(5)14-7)3-6(11)9(12)13/h4-5,7-8,10H,1-3H2,(H,12,13)/p-1/t4-,5+,7+,8-/m0/s1 |
| InChIKey | GDGJNVNXUIMBFT-LAHCRNKXSA-M |
| XLogP | -1.77 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|