C13H22N4O5 — CID 86583462
(2S)-2-[[(2S)-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]-2-azaniumylpropanoyl]amino]-4-methylpentanoate (PubChem CID 86583462) has the molecular formula C13H22N4O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]-2-azaniumylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | (2S)-2-[[(2S)-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]-2-azaniumylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 86583462 |
| Molecular Formula | C13H22N4O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2S)-2-[[(2S)-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]-2-azaniumylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]([NH3+])CNC(=O)/C=C/C(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C13H22N4O5/c1-7(2)5-9(13(21)22)17-12(20)8(14)6-16-11(19)4-3-10(15)18/h3-4,7-9H,5-6,14H2,1-2H3,(H2,15,18)(H,16,19)(H,17,20)(H,21,22)/b4-3+/t8-,9-/m0/s1 |
| InChIKey | MJPKMDAPFRGJGV-FBFNWGNUSA-N |
| XLogP | -3.96 |
| TPSA | 169.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|