C15H25O8P2-3 — CID 86583470
[[(2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate (PubChem CID 86583470) has the molecular formula C15H25O8P2-3 and a molecular weight of 395.31 g/mol. Its IUPAC name is [[(2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate.
| Compound Name | [[(2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 86583470 |
| Molecular Formula | C15H25O8P2-3 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [[(2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-])CO |
| InChI | InChI=1S/C15H28O8P2/c1-13(7-5-9-15(3)12-16)6-4-8-14(2)10-11-22-25(20,21)23-24(17,18)19/h6,9-10,16H,4-5,7-8,11-12H2,1-3H3,(H,20,21)(H2,17,18,19)/p-3/b13-6+,14-10+,15-9+ |
| InChIKey | SYIRLGLBHJFFBK-RDUMTQBOSA-K |
| XLogP | 1.71 |
| TPSA | 142.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|