About N,N-diethylethanamine;methylsulfinylmethane
N,N-diethylethanamine;methylsulfinylmethane (PubChem CID 86583882) has the molecular formula C8H21NOS
and a molecular weight of 179.33 g/mol. Its IUPAC name is N,N-diethylethanamine;methylsulfinylmethane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;methylsulfinylmethane |
| PubChem CID | 86583882 |
| Molecular Formula | C8H21NOS |
| Molecular Weight | 179.33 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N,N-diethylethanamine;methylsulfinylmethane |
| SMILES | CCN(CC)CC.CS(C)=O |
| InChI | InChI=1S/C6H15N.C2H6OS/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3;1-2H3 |
| InChIKey | ITFZASUFZUCDSU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;methylsulfinylmethane?
The IUPAC name of N,N-diethylethanamine;methylsulfinylmethane (CID 86583882) is N,N-diethylethanamine;methylsulfinylmethane.
What is the SMILES notation for N,N-diethylethanamine;methylsulfinylmethane?
The canonical SMILES for N,N-diethylethanamine;methylsulfinylmethane is CCN(CC)CC.CS(C)=O.
What is the InChIKey of N,N-diethylethanamine;methylsulfinylmethane?
The InChIKey is ITFZASUFZUCDSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H6OS/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3;1-2H3.
What are the key properties of N,N-diethylethanamine;methylsulfinylmethane?
N,N-diethylethanamine;methylsulfinylmethane has a molecular weight of 179.33 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;methylsulfinylmethane is sourced from PubChem (CID 86583882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).