C14H21IN4O — CID 86583903
2-[2-(1,4-diazepan-1-yl)benzimidazol-1-yl]ethanol;hydroiodide (PubChem CID 86583903) has the molecular formula C14H21IN4O and a molecular weight of 388.25 g/mol. Its IUPAC name is 2-[2-(1,4-diazepan-1-yl)benzimidazol-1-yl]ethanol;hydroiodide.
| Compound Name | 2-[2-(1,4-diazepan-1-yl)benzimidazol-1-yl]ethanol;hydroiodide |
|---|---|
| PubChem CID | 86583903 |
| Molecular Formula | C14H21IN4O |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[2-(1,4-diazepan-1-yl)benzimidazol-1-yl]ethanol;hydroiodide |
| SMILES | I.OCCn1c(N2CCCNCC2)nc2ccccc21 |
| InChI | InChI=1S/C14H20N4O.HI/c19-11-10-18-13-5-2-1-4-12(13)16-14(18)17-8-3-6-15-7-9-17;/h1-2,4-5,15,19H,3,6-11H2;1H |
| InChIKey | WDTNQAVZRXNFBR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|