About N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane
N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane (PubChem CID 86583969) has the molecular formula C10H26N3O2P
and a molecular weight of 251.31 g/mol. Its IUPAC name is N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane.
Molecular Properties
| Compound Name | N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane |
| PubChem CID | 86583969 |
| Molecular Formula | C10H26N3O2P |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane |
| SMILES | C1CCOC1.CN(C)P(=O)(N(C)C)N(C)C |
| InChI | InChI=1S/C6H18N3OP.C4H8O/c1-7(2)11(10,8(3)4)9(5)6;1-2-4-5-3-1/h1-6H3;1-4H2 |
| InChIKey | ONDXXAPHPJPFKQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane?
The IUPAC name of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane (CID 86583969) is N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane.
What is the SMILES notation for N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane?
The canonical SMILES for N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane is C1CCOC1.CN(C)P(=O)(N(C)C)N(C)C.
What is the InChIKey of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane?
The InChIKey is ONDXXAPHPJPFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N3OP.C4H8O/c1-7(2)11(10,8(3)4)9(5)6;1-2-4-5-3-1/h1-6H3;1-4H2.
What are the key properties of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane?
N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane has a molecular weight of 251.31 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;oxolane is sourced from PubChem (CID 86583969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).