C8H11BrN2 — CID 86584174
8-bromo-2,3,4,7-tetrahydro-1H-1,8-naphthyridine (PubChem CID 86584174) has the molecular formula C8H11BrN2 and a molecular weight of 215.09 g/mol. Its IUPAC name is 8-bromo-2,3,4,7-tetrahydro-1H-1,8-naphthyridine.
| Compound Name | 8-bromo-2,3,4,7-tetrahydro-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 86584174 |
| Molecular Formula | C8H11BrN2 |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 8-bromo-2,3,4,7-tetrahydro-1H-1,8-naphthyridine |
| SMILES | BrN1CC=CC2=C1NCCC2 |
| InChI | InChI=1S/C8H11BrN2/c9-11-6-2-4-7-3-1-5-10-8(7)11/h2,4,10H,1,3,5-6H2 |
| InChIKey | ZGZPKKMHMFBYES-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|