About ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate
ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate (PubChem CID 86584490) has the molecular formula C20H29NO3
and a molecular weight of 331.46 g/mol. Its IUPAC name is ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate.
Molecular Properties
| Compound Name | ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate |
| PubChem CID | 86584490 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate |
| SMILES | CCCCCC(C(=O)OCC)c1ccc2c(c1)C(C)(C)CC(=O)N2 |
| InChI | InChI=1S/C20H29NO3/c1-5-7-8-9-15(19(23)24-6-2)14-10-11-17-16(12-14)20(3,4)13-18(22)21-17/h10-12,15H,5-9,13H2,1-4H3,(H,21,22) |
| InChIKey | ISDFOEMIGAZJIU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate?
The IUPAC name of ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate (CID 86584490) is ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate.
What is the SMILES notation for ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate?
The canonical SMILES for ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate is CCCCCC(C(=O)OCC)c1ccc2c(c1)C(C)(C)CC(=O)N2.
What is the InChIKey of ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate?
The InChIKey is ISDFOEMIGAZJIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO3/c1-5-7-8-9-15(19(23)24-6-2)14-10-11-17-16(12-14)20(3,4)13-18(22)21-17/h10-12,15H,5-9,13H2,1-4H3,(H,21,22).
What are the key properties of ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate?
ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate has a molecular weight of 331.46 g/mol, XLogP of 4.53, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)heptanoate is sourced from PubChem (CID 86584490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).