C18H21N3O6S — CID 86584785
methyl 3-[3-[4-(4-formylpiperidin-1-yl)sulfonylphenyl]-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 86584785) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is methyl 3-[3-[4-(4-formylpiperidin-1-yl)sulfonylphenyl]-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | methyl 3-[3-[4-(4-formylpiperidin-1-yl)sulfonylphenyl]-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 86584785 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 3-[3-[4-(4-formylpiperidin-1-yl)sulfonylphenyl]-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | COC(=O)CCc1nc(-c2ccc(S(=O)(=O)N3CCC(C=O)CC3)cc2)no1 |
| InChI | InChI=1S/C18H21N3O6S/c1-26-17(23)7-6-16-19-18(20-27-16)14-2-4-15(5-3-14)28(24,25)21-10-8-13(12-22)9-11-21/h2-5,12-13H,6-11H2,1H3 |
| InChIKey | FTSXWGRLQAMTOC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 119.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|