C17H18BrN3O2 — CID 86584816
1-[3-(4-bromophenyl)-1-[[(2S)-oxiran-2-yl]methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 86584816) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 1-[3-(4-bromophenyl)-1-[[(2S)-oxiran-2-yl]methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[3-(4-bromophenyl)-1-[[(2S)-oxiran-2-yl]methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 86584816 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-[3-(4-bromophenyl)-1-[[(2S)-oxiran-2-yl]methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1CCc2c(c(-c3ccc(Br)cc3)nn2C[C@H]2CO2)C1 |
| InChI | InChI=1S/C17H18BrN3O2/c1-11(22)20-7-6-16-15(9-20)17(12-2-4-13(18)5-3-12)19-21(16)8-14-10-23-14/h2-5,14H,6-10H2,1H3/t14-/m0/s1 |
| InChIKey | OGNQUNXULUEASU-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 50.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|