C19H26F2N2O4S — CID 86584843
2-[[(2S,4R)-1-butoxycarbonyl-4-sulfanylpyrrolidin-2-yl]methyl-[(2,5-difluorophenyl)methyl]amino]acetic acid (PubChem CID 86584843) has the molecular formula C19H26F2N2O4S and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-[[(2S,4R)-1-butoxycarbonyl-4-sulfanylpyrrolidin-2-yl]methyl-[(2,5-difluorophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[[(2S,4R)-1-butoxycarbonyl-4-sulfanylpyrrolidin-2-yl]methyl-[(2,5-difluorophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 86584843 |
| Molecular Formula | C19H26F2N2O4S |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[[(2S,4R)-1-butoxycarbonyl-4-sulfanylpyrrolidin-2-yl]methyl-[(2,5-difluorophenyl)methyl]amino]acetic acid |
| SMILES | CCCCOC(=O)N1C[C@H](S)C[C@H]1CN(CC(=O)O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C19H26F2N2O4S/c1-2-3-6-27-19(26)23-11-16(28)8-15(23)10-22(12-18(24)25)9-13-7-14(20)4-5-17(13)21/h4-5,7,15-16,28H,2-3,6,8-12H2,1H3,(H,24,25)/t15-,16+/m0/s1 |
| InChIKey | LKNGMLAJOWJLCN-JKSUJKDBSA-N |
| XLogP | 3.16 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|