About 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine
2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 865849) has the molecular formula C11H11ClN4S
and a molecular weight of 266.76 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
| PubChem CID | 865849 |
| Molecular Formula | C11H11ClN4S |
| Molecular Weight | 266.76 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C11H11ClN4S/c12-8-3-1-7(2-4-8)6-17-11-15-9(13)5-10(14)16-11/h1-5H,6H2,(H4,13,14,15,16) |
| InChIKey | ZNAXZJJCUSOCGP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine?
The IUPAC name of 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine (CID 865849) is 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine.
What is the SMILES notation for 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine?
The canonical SMILES for 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine is Nc1cc(N)nc(SCc2ccc(Cl)cc2)n1.
What is the InChIKey of 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine?
The InChIKey is ZNAXZJJCUSOCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN4S/c12-8-3-1-7(2-4-8)6-17-11-15-9(13)5-10(14)16-11/h1-5H,6H2,(H4,13,14,15,16).
What are the key properties of 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine?
2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine has a molecular weight of 266.76 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine is sourced from PubChem (CID 865849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).