About 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate
3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate (PubChem CID 86585100) has the molecular formula C6H10F3NO4S
and a molecular weight of 249.21 g/mol. Its IUPAC name is 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate.
Molecular Properties
| Compound Name | 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate |
| PubChem CID | 86585100 |
| Molecular Formula | C6H10F3NO4S |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO4S/c1-15(12,13)14-4-2-3-10-5(11)6(7,8)9/h2-4H2,1H3,(H,10,11) |
| InChIKey | FRBAUYAAVNEGFE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate?
The IUPAC name of 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate (CID 86585100) is 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate.
What is the SMILES notation for 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate?
The canonical SMILES for 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate is CS(=O)(=O)OCCCNC(=O)C(F)(F)F.
What is the InChIKey of 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate?
The InChIKey is FRBAUYAAVNEGFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO4S/c1-15(12,13)14-4-2-3-10-5(11)6(7,8)9/h2-4H2,1H3,(H,10,11).
What are the key properties of 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate?
3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate has a molecular weight of 249.21 g/mol, XLogP of 0.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2,2-trifluoroacetyl)amino]propyl methanesulfonate is sourced from PubChem (CID 86585100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).