About 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride
2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride (PubChem CID 86585201) has the molecular formula C16H32Cl2N4O
and a molecular weight of 367.37 g/mol. Its IUPAC name is 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride |
| PubChem CID | 86585201 |
| Molecular Formula | C16H32Cl2N4O |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(N)CC(C)(C)C)CC1.Cl.Cl |
| InChI | InChI=1S/C16H30N4O.2ClH/c1-5-8-20-9-6-16(12-17,7-10-20)19-14(21)13(18)11-15(2,3)4;;/h13H,5-11,18H2,1-4H3,(H,19,21);2*1H |
| InChIKey | GRNSBKYVCZORDP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride?
The IUPAC name of 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride (CID 86585201) is 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride.
What is the SMILES notation for 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride?
The canonical SMILES for 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride is CCCN1CCC(C#N)(NC(=O)C(N)CC(C)(C)C)CC1.Cl.Cl.
What is the InChIKey of 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride?
The InChIKey is GRNSBKYVCZORDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4O.2ClH/c1-5-8-20-9-6-16(12-17,7-10-20)19-14(21)13(18)11-15(2,3)4;;/h13H,5-11,18H2,1-4H3,(H,19,21);2*1H.
What are the key properties of 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride?
2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride has a molecular weight of 367.37 g/mol, XLogP of 2.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide;dihydrochloride is sourced from PubChem (CID 86585201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).