C16H17NO6S3 — CID 86585228
2,3-dimethyl-1,3-benzothiazol-3-ium-6-sulfonic acid;4-methylbenzenesulfonate (PubChem CID 86585228) has the molecular formula C16H17NO6S3 and a molecular weight of 415.51 g/mol. Its IUPAC name is 2,3-dimethyl-1,3-benzothiazol-3-ium-6-sulfonic acid;4-methylbenzenesulfonate.
| Compound Name | 2,3-dimethyl-1,3-benzothiazol-3-ium-6-sulfonic acid;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86585228 |
| Molecular Formula | C16H17NO6S3 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 2,3-dimethyl-1,3-benzothiazol-3-ium-6-sulfonic acid;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cc1sc2cc(S(=O)(=O)O)ccc2[n+]1C |
| InChI | InChI=1S/C9H9NO3S2.C7H8O3S/c1-6-10(2)8-4-3-7(15(11,12)13)5-9(8)14-6;1-6-2-4-7(5-3-6)11(8,9)10/h3-5H,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | FYGAFHLNFVECQT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|