About tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate
tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate (PubChem CID 86585772) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate.
Molecular Properties
| Compound Name | tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate |
| PubChem CID | 86585772 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate |
| SMILES | CCOC(=O)/C=C/c1cccc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H20O4/c1-5-19-14(17)10-9-12-7-6-8-13(11-12)15(18)20-16(2,3)4/h6-11H,5H2,1-4H3/b10-9+ |
| InChIKey | JQUQBVGPFCOXGV-MDZDMXLPSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate?
The IUPAC name of tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate (CID 86585772) is tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate.
What is the SMILES notation for tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate?
The canonical SMILES for tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate is CCOC(=O)/C=C/c1cccc(C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate?
The InChIKey is JQUQBVGPFCOXGV-MDZDMXLPSA-N. The full InChI is InChI=1S/C16H20O4/c1-5-19-14(17)10-9-12-7-6-8-13(11-12)15(18)20-16(2,3)4/h6-11H,5H2,1-4H3/b10-9+.
What are the key properties of tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate?
tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate has a molecular weight of 276.33 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoate is sourced from PubChem (CID 86585772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).